C15H32FNO6P2 — CID 134189842
tert-butyl N-(4-diethoxyphosphoryl-4-dimethylphosphoryl-4-fluorobutyl)carbamate (PubChem CID 134189842) has the molecular formula C15H32FNO6P2 and a molecular weight of 403.37 g/mol. Its IUPAC name is tert-butyl N-(4-diethoxyphosphoryl-4-dimethylphosphoryl-4-fluorobutyl)carbamate.
| Compound Name | tert-butyl N-(4-diethoxyphosphoryl-4-dimethylphosphoryl-4-fluorobutyl)carbamate |
|---|---|
| PubChem CID | 134189842 |
| Molecular Formula | C15H32FNO6P2 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | tert-butyl N-(4-diethoxyphosphoryl-4-dimethylphosphoryl-4-fluorobutyl)carbamate |
| SMILES | CCOP(=O)(OCC)C(F)(CCCNC(=O)OC(C)(C)C)P(C)(C)=O |
| InChI | InChI=1S/C15H32FNO6P2/c1-8-21-25(20,22-9-2)15(16,24(6,7)19)11-10-12-17-13(18)23-14(3,4)5/h8-12H2,1-7H3,(H,17,18) |
| InChIKey | ROINOEMZCHOPEQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|