C20H34NO5P — CID 123627272
tert-butyl N-[4-(3-diethoxyphosphorylpentan-3-yl)phenyl]carbamate (PubChem CID 123627272) has the molecular formula C20H34NO5P and a molecular weight of 399.47 g/mol. Its IUPAC name is tert-butyl N-[4-(3-diethoxyphosphorylpentan-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-diethoxyphosphorylpentan-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 123627272 |
| Molecular Formula | C20H34NO5P |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl N-[4-(3-diethoxyphosphorylpentan-3-yl)phenyl]carbamate |
| SMILES | CCOP(=O)(OCC)C(CC)(CC)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34NO5P/c1-8-20(9-2,27(23,24-10-3)25-11-4)16-12-14-17(15-13-16)21-18(22)26-19(5,6)7/h12-15H,8-11H2,1-7H3,(H,21,22) |
| InChIKey | DCCFPVIXMLBORR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|