C22H22BrF2O5PS — CID 168955260
3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(2-phenylethyl)-1-benzothiophene-5-carboxylic acid (PubChem CID 168955260) has the molecular formula C22H22BrF2O5PS and a molecular weight of 547.35 g/mol. Its IUPAC name is 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(2-phenylethyl)-1-benzothiophene-5-carboxylic acid.
| Compound Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(2-phenylethyl)-1-benzothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 168955260 |
| Molecular Formula | C22H22BrF2O5PS |
| Molecular Weight | 547.35 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(2-phenylethyl)-1-benzothiophene-5-carboxylic acid |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2c(CCc3ccccc3)cc(C(=O)O)cc2c1Br |
| InChI | InChI=1S/C22H22BrF2O5PS/c1-3-29-31(28,30-4-2)22(24,25)20-18(23)17-13-16(21(26)27)12-15(19(17)32-20)11-10-14-8-6-5-7-9-14/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,26,27) |
| InChIKey | XNXXRRDVJUMCNC-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.35 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|