C16H24BrFNO4PS — CID 168954840
3-bromo-2-[ethoxyphosphanyl(fluoro)methyl]-7-hydroxy-1-benzothiophene-5-carboxamide;ethane;ethanol (PubChem CID 168954840) has the molecular formula C16H24BrFNO4PS and a molecular weight of 456.31 g/mol. Its IUPAC name is 3-bromo-2-[ethoxyphosphanyl(fluoro)methyl]-7-hydroxy-1-benzothiophene-5-carboxamide;ethane;ethanol.
| Compound Name | 3-bromo-2-[ethoxyphosphanyl(fluoro)methyl]-7-hydroxy-1-benzothiophene-5-carboxamide;ethane;ethanol |
|---|---|
| PubChem CID | 168954840 |
| Molecular Formula | C16H24BrFNO4PS |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 3-bromo-2-[ethoxyphosphanyl(fluoro)methyl]-7-hydroxy-1-benzothiophene-5-carboxamide;ethane;ethanol |
| SMILES | CC.CCO.CCOPC(F)c1sc2c(O)cc(C(N)=O)cc2c1Br |
| InChI | InChI=1S/C12H12BrFNO3PS.C2H6O.C2H6/c1-2-18-19-11(14)10-8(13)6-3-5(12(15)17)4-7(16)9(6)20-10;1-2-3;1-2/h3-4,11,16,19H,2H2,1H3,(H2,15,17);3H,2H2,1H3;1-2H3 |
| InChIKey | PBGXVEIJBJZIQD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|