C18H14BrF2N2O4PS — CID 175683187
[[3-bromo-5-[(1-pyridin-3-ylcyclopropyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683187) has the molecular formula C18H14BrF2N2O4PS and a molecular weight of 503.26 g/mol. Its IUPAC name is [[3-bromo-5-[(1-pyridin-3-ylcyclopropyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[(1-pyridin-3-ylcyclopropyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683187 |
| Molecular Formula | C18H14BrF2N2O4PS |
| Molecular Weight | 503.26 g/mol |
| Exact Mass | 501.96 |
| IUPAC Name | [[3-bromo-5-[(1-pyridin-3-ylcyclopropyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(NC1(c2cccnc2)CC1)c1ccc2sc(C(F)(F)P(=O)(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C18H14BrF2N2O4PS/c19-14-12-8-10(3-4-13(12)29-15(14)18(20,21)28(25,26)27)16(24)23-17(5-6-17)11-2-1-7-22-9-11/h1-4,7-9H,5-6H2,(H,23,24)(H2,25,26,27) |
| InChIKey | HGYCJOZKAJUEDK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|