C21H19BrF2NO6PS — CID 175683051
[[3-bromo-5-[[4-(oxolan-2-ylmethoxy)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683051) has the molecular formula C21H19BrF2NO6PS and a molecular weight of 562.33 g/mol. Its IUPAC name is [[3-bromo-5-[[4-(oxolan-2-ylmethoxy)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[[4-(oxolan-2-ylmethoxy)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683051 |
| Molecular Formula | C21H19BrF2NO6PS |
| Molecular Weight | 562.33 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | [[3-bromo-5-[[4-(oxolan-2-ylmethoxy)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(Nc1ccc(OCC2CCCO2)cc1)c1ccc2sc(C(F)(F)P(=O)(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C21H19BrF2NO6PS/c22-18-16-10-12(3-8-17(16)33-19(18)21(23,24)32(27,28)29)20(26)25-13-4-6-14(7-5-13)31-11-15-2-1-9-30-15/h3-8,10,15H,1-2,9,11H2,(H,25,26)(H2,27,28,29) |
| InChIKey | QPUAZJXQRPFHRI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|