About 2-butyl-4H-1,3-oxazol-5-one
2-butyl-4H-1,3-oxazol-5-one (PubChem CID 119087763) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-butyl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-butyl-4H-1,3-oxazol-5-one |
| PubChem CID | 119087763 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-butyl-4H-1,3-oxazol-5-one |
| SMILES | CCCCC1=NCC(=O)O1 |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-6-8-5-7(9)10-6/h2-5H2,1H3 |
| InChIKey | FMEUKKFBDWAHNS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4H-1,3-oxazol-5-one?
The IUPAC name of 2-butyl-4H-1,3-oxazol-5-one (CID 119087763) is 2-butyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for 2-butyl-4H-1,3-oxazol-5-one?
The canonical SMILES for 2-butyl-4H-1,3-oxazol-5-one is CCCCC1=NCC(=O)O1.
What is the InChIKey of 2-butyl-4H-1,3-oxazol-5-one?
The InChIKey is FMEUKKFBDWAHNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-6-8-5-7(9)10-6/h2-5H2,1H3.
What are the key properties of 2-butyl-4H-1,3-oxazol-5-one?
2-butyl-4H-1,3-oxazol-5-one has a molecular weight of 141.17 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 119087763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).