C9H9NOS — CID 119087853
1-(1,2-benzothiazol-4-yl)ethanol (PubChem CID 119087853) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-4-yl)ethanol.
| Compound Name | 1-(1,2-benzothiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 119087853 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 1-(1,2-benzothiazol-4-yl)ethanol |
| SMILES | CC(O)c1cccc2sncc12 |
| InChI | InChI=1S/C9H9NOS/c1-6(11)7-3-2-4-9-8(7)5-10-12-9/h2-6,11H,1H3 |
| InChIKey | LVABJFWRYTWAQZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |