C8H10N4 — CID 119091298
2,6-bis(methylamino)pyridine-3-carbonitrile (PubChem CID 119091298) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,6-bis(methylamino)pyridine-3-carbonitrile.
| Compound Name | 2,6-bis(methylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119091298 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,6-bis(methylamino)pyridine-3-carbonitrile |
| SMILES | CNc1ccc(C#N)c(NC)n1 |
| InChI | InChI=1S/C8H10N4/c1-10-7-4-3-6(5-9)8(11-2)12-7/h3-4H,1-2H3,(H2,10,11,12) |
| InChIKey | ZYSLOWCNDYTRCU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |