C23H29N4O2S+ — CID 11909164
2-[[4-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 11909164) has the molecular formula C23H29N4O2S+ and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[[4-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[4-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11909164 |
| Molecular Formula | C23H29N4O2S+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[[4-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C([C@H]1C[C@@H]2C=C[C@H]1C2)N1CC[NH+](Cc2nc3sc4c(c3c(=O)[nH]2)CCCC4)CC1 |
| InChI | InChI=1S/C23H28N4O2S/c28-21-20-16-3-1-2-4-18(16)30-22(20)25-19(24-21)13-26-7-9-27(10-8-26)23(29)17-12-14-5-6-15(17)11-14/h5-6,14-15,17H,1-4,7-13H2,(H,24,25,28)/p+1/t14-,15+,17+/m1/s1 |
| InChIKey | KROYFJNXTSYMTI-VYDXJSESSA-O |
| XLogP | 1.30 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|