C23H27N4O5S2+ — CID 2462107
2-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2462107) has the molecular formula C23H27N4O5S2+ and a molecular weight of 503.63 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2462107 |
| Molecular Formula | C23H27N4O5S2+ |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 2-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C[NH+]2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H26N4O5S2/c28-22-21-16-3-1-2-4-19(16)33-23(21)25-20(24-22)14-26-7-9-27(10-8-26)34(29,30)15-5-6-17-18(13-15)32-12-11-31-17/h5-6,13H,1-4,7-12,14H2,(H,24,25,28)/p+1 |
| InChIKey | ZIEJNJDOGXYEOF-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |