C12H15Cl3O2 — CID 119091928
1-(2-butoxyphenyl)-2,2,2-trichloroethanol (PubChem CID 119091928) has the molecular formula C12H15Cl3O2 and a molecular weight of 297.61 g/mol. Its IUPAC name is 1-(2-butoxyphenyl)-2,2,2-trichloroethanol.
| Compound Name | 1-(2-butoxyphenyl)-2,2,2-trichloroethanol |
|---|---|
| PubChem CID | 119091928 |
| Molecular Formula | C12H15Cl3O2 |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1-(2-butoxyphenyl)-2,2,2-trichloroethanol |
| SMILES | CCCCOc1ccccc1C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3O2/c1-2-3-8-17-10-7-5-4-6-9(10)11(16)12(13,14)15/h4-7,11,16H,2-3,8H2,1H3 |
| InChIKey | DLJBUYCHSVNXNA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|