C10H11Cl3O2 — CID 23460388
2,2,2-trichloro-1-(2-ethoxyphenyl)ethanol (PubChem CID 23460388) has the molecular formula C10H11Cl3O2 and a molecular weight of 269.56 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(2-ethoxyphenyl)ethanol.
| Compound Name | 2,2,2-trichloro-1-(2-ethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 23460388 |
| Molecular Formula | C10H11Cl3O2 |
| Molecular Weight | 269.56 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2,2,2-trichloro-1-(2-ethoxyphenyl)ethanol |
| SMILES | CCOc1ccccc1C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H11Cl3O2/c1-2-15-8-6-4-3-5-7(8)9(14)10(11,12)13/h3-6,9,14H,2H2,1H3 |
| InChIKey | IRTNSOSDRQAONU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|