About phthalazin-5-ylhydrazine
phthalazin-5-ylhydrazine (PubChem CID 119093508) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is phthalazin-5-ylhydrazine.
Molecular Properties
| Compound Name | phthalazin-5-ylhydrazine |
| PubChem CID | 119093508 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | phthalazin-5-ylhydrazine |
| SMILES | NNc1cccc2cnncc12 |
| InChI | InChI=1S/C8H8N4/c9-12-8-3-1-2-6-4-10-11-5-7(6)8/h1-5,12H,9H2 |
| InChIKey | OMBRKHLCZHSABX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phthalazin-5-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazin-5-ylhydrazine?
The IUPAC name of phthalazin-5-ylhydrazine (CID 119093508) is phthalazin-5-ylhydrazine.
What is the SMILES notation for phthalazin-5-ylhydrazine?
The canonical SMILES for phthalazin-5-ylhydrazine is NNc1cccc2cnncc12.
What is the InChIKey of phthalazin-5-ylhydrazine?
The InChIKey is OMBRKHLCZHSABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-12-8-3-1-2-6-4-10-11-5-7(6)8/h1-5,12H,9H2.
What are the key properties of phthalazin-5-ylhydrazine?
phthalazin-5-ylhydrazine has a molecular weight of 160.18 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazin-5-ylhydrazine is sourced from PubChem (CID 119093508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).