C17H24N4S — CID 3619413
1-phthalazin-5-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 3619413) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-phthalazin-5-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-phthalazin-5-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 3619413 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-phthalazin-5-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)Nc1cccc2cnncc12 |
| InChI | InChI=1S/C17H24N4S/c1-16(2,3)11-17(4,5)21-15(22)20-14-8-6-7-12-9-18-19-10-13(12)14/h6-10H,11H2,1-5H3,(H2,20,21,22) |
| InChIKey | DKGSIHSLCZFMLN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|