C15H22Br2N2OS — CID 87656684
1-(3,5-dibromo-4-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 87656684) has the molecular formula C15H22Br2N2OS and a molecular weight of 438.23 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-(3,5-dibromo-4-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 87656684 |
| Molecular Formula | C15H22Br2N2OS |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 1-(3,5-dibromo-4-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H22Br2N2OS/c1-14(2,3)8-15(4,5)19-13(21)18-9-6-10(16)12(20)11(17)7-9/h6-7,20H,8H2,1-5H3,(H2,18,19,21) |
| InChIKey | PSMRBLKKGXAQHY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|