C11H11NO2 — CID 119093682
4,5-dimethoxyisoquinoline (PubChem CID 119093682) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4,5-dimethoxyisoquinoline.
| Compound Name | 4,5-dimethoxyisoquinoline |
|---|---|
| PubChem CID | 119093682 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 4,5-dimethoxyisoquinoline |
| SMILES | COc1cccc2cncc(OC)c12 |
| InChI | InChI=1S/C11H11NO2/c1-13-9-5-3-4-8-6-12-7-10(14-2)11(8)9/h3-7H,1-2H3 |
| InChIKey | XAHXCJOUFVMQRB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |