C5H3Cl2N5 — CID 119093899
2,4-dichloro-6-(1-diazoethyl)-1,3,5-triazine (PubChem CID 119093899) has the molecular formula C5H3Cl2N5 and a molecular weight of 204.02 g/mol. Its IUPAC name is 2,4-dichloro-6-(1-diazoethyl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(1-diazoethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 119093899 |
| Molecular Formula | C5H3Cl2N5 |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | 2,4-dichloro-6-(1-diazoethyl)-1,3,5-triazine |
| SMILES | CC(=[N+]=[N-])c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H3Cl2N5/c1-2(12-8)3-9-4(6)11-5(7)10-3/h1H3 |
| InChIKey | AAPIKCBVNSLNJU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|