C5H5Cl2N3 — CID 12776
2,4-dichloro-6-ethyl-1,3,5-triazine (PubChem CID 12776) has the molecular formula C5H5Cl2N3 and a molecular weight of 178.02 g/mol. Its IUPAC name is 2,4-dichloro-6-ethyl-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-ethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 12776 |
| Molecular Formula | C5H5Cl2N3 |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.99 |
| IUPAC Name | 2,4-dichloro-6-ethyl-1,3,5-triazine |
| SMILES | CCc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H5Cl2N3/c1-2-3-8-4(6)10-5(7)9-3/h2H2,1H3 |
| InChIKey | ADVXAMGGIRUOKU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |