C6H14N2O — CID 119097706
3,4-diethyl-1,3,4-oxadiazolidine (PubChem CID 119097706) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is 3,4-diethyl-1,3,4-oxadiazolidine.
| Compound Name | 3,4-diethyl-1,3,4-oxadiazolidine |
|---|---|
| PubChem CID | 119097706 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 3,4-diethyl-1,3,4-oxadiazolidine |
| SMILES | CCN1COCN1CC |
| InChI | InChI=1S/C6H14N2O/c1-3-7-5-9-6-8(7)4-2/h3-6H2,1-2H3 |
| InChIKey | VQWWTMGMRQKJOA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |