C18H17ClN2O2S2 — CID 119099264
1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2,2-dithiophen-2-ylethyl)urea (PubChem CID 119099264) has the molecular formula C18H17ClN2O2S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2,2-dithiophen-2-ylethyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2,2-dithiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 119099264 |
| Molecular Formula | C18H17ClN2O2S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2-hydroxy-2,2-dithiophen-2-ylethyl)urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)NCC(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H17ClN2O2S2/c19-14-7-5-13(6-8-14)11-20-17(22)21-12-18(23,15-3-1-9-24-15)16-4-2-10-25-16/h1-10,23H,11-12H2,(H2,20,21,22) |
| InChIKey | KLFHOJXQTFQJAV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |