C20H25N4O4+ — CID 11910082
3-[(1S,3S,3aR,6aS)-5-tert-butyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 11910082) has the molecular formula C20H25N4O4+ and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-[(1S,3S,3aR,6aS)-5-tert-butyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1S,3S,3aR,6aS)-5-tert-butyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 11910082 |
| Molecular Formula | C20H25N4O4+ |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-[(1S,3S,3aR,6aS)-5-tert-butyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | CC(C)(C)N1C(=O)[C@@H]2[C@H](CCC(N)=O)[NH2+][C@@]3(C(=O)Nc4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C20H24N4O4/c1-19(2,3)24-16(26)14-12(8-9-13(21)25)23-20(15(14)17(24)27)10-6-4-5-7-11(10)22-18(20)28/h4-7,12,14-15,23H,8-9H2,1-3H3,(H2,21,25)(H,22,28)/p+1/t12-,14+,15-,20+/m0/s1 |
| InChIKey | XWNOOIIVMBMZTL-CFEDGUPZSA-O |
| XLogP | -0.56 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|