C19H15NO3S2 — CID 119101200
N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-1-benzothiophene-2-carboxamide (PubChem CID 119101200) has the molecular formula C19H15NO3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 119101200 |
| Molecular Formula | C19H15NO3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(O)(c1ccoc1)c1cccs1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C19H15NO3S2/c21-18(16-10-13-4-1-2-5-15(13)25-16)20-12-19(22,14-7-8-23-11-14)17-6-3-9-24-17/h1-11,22H,12H2,(H,20,21) |
| InChIKey | FUVBEXDKWIAXOQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |