C19H19NO3S2 — CID 129416706
2-ethylsulfanyl-N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]benzamide (PubChem CID 129416706) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 2-ethylsulfanyl-N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 129416706 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-ethylsulfanyl-N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]benzamide |
| SMILES | CCSc1ccccc1C(=O)NC[C@](O)(c1ccoc1)c1cccs1 |
| InChI | InChI=1S/C19H19NO3S2/c1-2-24-16-7-4-3-6-15(16)18(21)20-13-19(22,14-9-10-23-12-14)17-8-5-11-25-17/h3-12,22H,2,13H2,1H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | GJJPAAHVHZJJBF-IBGZPJMESA-N |
| XLogP | 4.12 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |