C18H13F3N2O4 — CID 119101900
N-[[5-(furan-2-yl)furan-2-yl]methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 119101900) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)furan-2-yl]methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[[5-(furan-2-yl)furan-2-yl]methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 119101900 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[[5-(furan-2-yl)furan-2-yl]methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(NCc1ccc(-c2ccco2)o1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O4/c19-18(20,21)12-4-1-2-5-13(12)23-17(25)16(24)22-10-11-7-8-15(27-11)14-6-3-9-26-14/h1-9H,10H2,(H,22,24)(H,23,25) |
| InChIKey | HDTDLOBCRVGYBR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|