C19H15F2N3O2S — CID 119102370
(Z)-3-(2,5-difluorophenyl)-1-[3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 119102370) has the molecular formula C19H15F2N3O2S and a molecular weight of 387.41 g/mol. Its IUPAC name is (Z)-3-(2,5-difluorophenyl)-1-[3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(2,5-difluorophenyl)-1-[3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 119102370 |
| Molecular Formula | C19H15F2N3O2S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (Z)-3-(2,5-difluorophenyl)-1-[3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C\c1cc(F)ccc1F)N1CCC(c2noc(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C19H15F2N3O2S/c20-14-4-5-15(21)12(10-14)3-6-17(25)24-8-7-13(11-24)18-22-19(26-23-18)16-2-1-9-27-16/h1-6,9-10,13H,7-8,11H2/b6-3- |
| InChIKey | AZZCVVGOFQJLJQ-UTCJRWHESA-N |
| XLogP | 4.11 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|