C14H12F3N3O2S — CID 129447759
(Z)-3-thiophen-2-yl-1-[(3S)-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 129447759) has the molecular formula C14H12F3N3O2S and a molecular weight of 343.33 g/mol. Its IUPAC name is (Z)-3-thiophen-2-yl-1-[(3S)-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-thiophen-2-yl-1-[(3S)-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129447759 |
| Molecular Formula | C14H12F3N3O2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (Z)-3-thiophen-2-yl-1-[(3S)-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C\c1cccs1)N1CC[C@H](c2noc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C14H12F3N3O2S/c15-14(16,17)13-18-12(19-22-13)9-5-6-20(8-9)11(21)4-3-10-2-1-7-23-10/h1-4,7,9H,5-6,8H2/b4-3-/t9-/m0/s1 |
| InChIKey | NAHDDXBVXPLEBK-TYRPZCRBSA-N |
| XLogP | 3.18 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|