C18H25BrN2O2 — CID 119108054
4-[(6-bromo-2H-chromen-3-yl)methylamino]-N,N-diethylbutanamide (PubChem CID 119108054) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 4-[(6-bromo-2H-chromen-3-yl)methylamino]-N,N-diethylbutanamide.
| Compound Name | 4-[(6-bromo-2H-chromen-3-yl)methylamino]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 119108054 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(6-bromo-2H-chromen-3-yl)methylamino]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCNCC1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C18H25BrN2O2/c1-3-21(4-2)18(22)6-5-9-20-12-14-10-15-11-16(19)7-8-17(15)23-13-14/h7-8,10-11,20H,3-6,9,12-13H2,1-2H3 |
| InChIKey | AABDIURINOWOND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|