C19H23N3O4S — CID 119108192
N,N-dimethyl-4-[1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide (PubChem CID 119108192) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119108192 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N,N-dimethyl-4-[1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide |
| SMILES | CC(NC/C=C/c1ccccc1[N+](=O)[O-])c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-15(16-10-12-18(13-11-16)27(25,26)21(2)3)20-14-6-8-17-7-4-5-9-19(17)22(23)24/h4-13,15,20H,14H2,1-3H3/b8-6+ |
| InChIKey | WBPLZQPKYRLNIO-SOFGYWHQSA-N |
| XLogP | 3.21 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|