C17H26N2O3 — CID 109380107
2,2,4-trimethyl-1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]pentan-3-ol (PubChem CID 109380107) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,2,4-trimethyl-1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]pentan-3-ol.
| Compound Name | 2,2,4-trimethyl-1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]pentan-3-ol |
|---|---|
| PubChem CID | 109380107 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2,2,4-trimethyl-1-[[(E)-3-(2-nitrophenyl)prop-2-enyl]amino]pentan-3-ol |
| SMILES | CC(C)C(O)C(C)(C)CNC/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O3/c1-13(2)16(20)17(3,4)12-18-11-7-9-14-8-5-6-10-15(14)19(21)22/h5-10,13,16,18,20H,11-12H2,1-4H3/b9-7+ |
| InChIKey | LERKKJXILJRWBQ-VQHVLOKHSA-N |
| XLogP | 3.24 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|