C20H24ClN3O3S — CID 11910821
(1R,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-7'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 11910821) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-7'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-7'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11910821 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (1R,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-7'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC[C@@H](C)N1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(N[C@@H]2CCSC)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-4-10(2)24-17(25)14-13(8-9-28-3)23-20(15(14)18(24)26)11-6-5-7-12(21)16(11)22-19(20)27/h5-7,10,13-15,23H,4,8-9H2,1-3H3,(H,22,27)/t10-,13-,14-,15+,20-/m1/s1 |
| InChIKey | XMNCZZGJRFMWAK-DVFSBPTISA-N |
| XLogP | 2.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|