C22H28ClN3O3 — CID 4897875
5-butan-2-yl-6'-chloro-7'-methyl-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4897875) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 5-butan-2-yl-6'-chloro-7'-methyl-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5-butan-2-yl-6'-chloro-7'-methyl-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4897875 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-butan-2-yl-6'-chloro-7'-methyl-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCC(C)N1C(=O)C2C(CC(C)C)NC3(C(=O)Nc4c3ccc(Cl)c4C)C2C1=O |
| InChI | InChI=1S/C22H28ClN3O3/c1-6-11(4)26-19(27)16-15(9-10(2)3)25-22(17(16)20(26)28)13-7-8-14(23)12(5)18(13)24-21(22)29/h7-8,10-11,15-17,25H,6,9H2,1-5H3,(H,24,29) |
| InChIKey | VMMFGLRMQARVNR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|