C25H23ClN4O6 — CID 29094132
ethyl 4-[(1S,3S,3aR,6aS)-1-(2-amino-2-oxoethyl)-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate (PubChem CID 29094132) has the molecular formula C25H23ClN4O6 and a molecular weight of 510.93 g/mol. Its IUPAC name is ethyl 4-[(1S,3S,3aR,6aS)-1-(2-amino-2-oxoethyl)-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate.
| Compound Name | ethyl 4-[(1S,3S,3aR,6aS)-1-(2-amino-2-oxoethyl)-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
|---|---|
| PubChem CID | 29094132 |
| Molecular Formula | C25H23ClN4O6 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | ethyl 4-[(1S,3S,3aR,6aS)-1-(2-amino-2-oxoethyl)-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](CC(N)=O)N[C@@]4(C(=O)Nc5c4ccc(Cl)c5C)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H23ClN4O6/c1-3-36-23(34)12-4-6-13(7-5-12)30-21(32)18-16(10-17(27)31)29-25(19(18)22(30)33)14-8-9-15(26)11(2)20(14)28-24(25)35/h4-9,16,18-19,29H,3,10H2,1-2H3,(H2,27,31)(H,28,35)/t16-,18+,19-,25+/m0/s1 |
| InChIKey | VTGHXFNCEBBMSE-VDLCSRDCSA-N |
| XLogP | 1.63 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|