C25H25ClN4O4 — CID 51554732
3-[(1S,3R,3aR,6aS)-6'-chloro-5-(4-ethylphenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 51554732) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is 3-[(1S,3R,3aR,6aS)-6'-chloro-5-(4-ethylphenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1S,3R,3aR,6aS)-6'-chloro-5-(4-ethylphenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 51554732 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-[(1S,3R,3aR,6aS)-6'-chloro-5-(4-ethylphenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | CCc1ccc(N2C(=O)[C@@H]3[C@H](CCC(N)=O)N[C@]4(C(=O)Nc5c4ccc(Cl)c5C)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H25ClN4O4/c1-3-13-4-6-14(7-5-13)30-22(32)19-17(10-11-18(27)31)29-25(20(19)23(30)33)15-8-9-16(26)12(2)21(15)28-24(25)34/h4-9,17,19-20,29H,3,10-11H2,1-2H3,(H2,27,31)(H,28,34)/t17-,19+,20-,25-/m0/s1 |
| InChIKey | SISNMOGMCWYMIA-UJAPCULTSA-N |
| XLogP | 2.40 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|