C29H24ClN3O5 — CID 124540301
methyl 2-[(1S,3S,3aS,6aS)-1-benzyl-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate (PubChem CID 124540301) has the molecular formula C29H24ClN3O5 and a molecular weight of 529.98 g/mol. Its IUPAC name is methyl 2-[(1S,3S,3aS,6aS)-1-benzyl-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate.
| Compound Name | methyl 2-[(1S,3S,3aS,6aS)-1-benzyl-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
|---|---|
| PubChem CID | 124540301 |
| Molecular Formula | C29H24ClN3O5 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | methyl 2-[(1S,3S,3aS,6aS)-1-benzyl-6'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@@H]2[C@H](Cc3ccccc3)N[C@@]3(C(=O)Nc4c3ccc(Cl)c4C)[C@H]2C1=O |
| InChI | InChI=1S/C29H24ClN3O5/c1-15-19(30)13-12-18-24(15)31-28(37)29(18)23-22(20(32-29)14-16-8-4-3-5-9-16)25(34)33(26(23)35)21-11-7-6-10-17(21)27(36)38-2/h3-13,20,22-23,32H,14H2,1-2H3,(H,31,37)/t20-,22+,23+,29+/m0/s1 |
| InChIKey | IOSRRQIAKBTPCU-LWXDNZILSA-N |
| XLogP | 3.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|