C31H26N4O5 — CID 95372881
methyl 2-[(1R,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate (PubChem CID 95372881) has the molecular formula C31H26N4O5 and a molecular weight of 534.57 g/mol. Its IUPAC name is methyl 2-[(1R,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate.
| Compound Name | methyl 2-[(1R,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
|---|---|
| PubChem CID | 95372881 |
| Molecular Formula | C31H26N4O5 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | methyl 2-[(1R,3R,3aR,6aS)-1-(1H-indol-3-ylmethyl)-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@H]2[C@@H](C1=O)[C@]1(N[C@@H]2Cc2c[nH]c3ccccc23)C(=O)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C31H26N4O5/c1-16-11-12-22-20(13-16)31(30(39)33-22)26-25(23(34-31)14-17-15-32-21-9-5-3-7-18(17)21)27(36)35(28(26)37)24-10-6-4-8-19(24)29(38)40-2/h3-13,15,23,25-26,32,34H,14H2,1-2H3,(H,33,39)/t23-,25-,26+,31+/m1/s1 |
| InChIKey | YVCBSDQKMXLUPC-AIHUPLDYSA-N |
| XLogP | 3.43 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|