C26H28N4O5 — CID 163080344
3-[(1R,3R,3aS,6aS)-5-[(4-methoxyphenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 163080344) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-[(1R,3R,3aS,6aS)-5-[(4-methoxyphenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1R,3R,3aS,6aS)-5-[(4-methoxyphenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 163080344 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-[(1R,3R,3aS,6aS)-5-[(4-methoxyphenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3[C@@H](CCC(N)=O)N[C@]4(C(=O)Nc5c4ccc(C)c5C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H28N4O5/c1-13-4-9-17-22(14(13)2)28-25(34)26(17)21-20(18(29-26)10-11-19(27)31)23(32)30(24(21)33)12-15-5-7-16(35-3)8-6-15/h4-9,18,20-21,29H,10-12H2,1-3H3,(H2,27,31)(H,28,34)/t18-,20-,21-,26+/m1/s1 |
| InChIKey | RQIONDPFZNNKIT-STLTWMRASA-N |
| XLogP | 1.50 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|