C25H24ClN3O5 — CID 162875337
3-[(1S,3S,3aS,6aS)-5-[(2-chlorophenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid (PubChem CID 162875337) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 3-[(1S,3S,3aS,6aS)-5-[(2-chlorophenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid.
| Compound Name | 3-[(1S,3S,3aS,6aS)-5-[(2-chlorophenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid |
|---|---|
| PubChem CID | 162875337 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[(1S,3S,3aS,6aS)-5-[(2-chlorophenyl)methyl]-6',7'-dimethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@@]21N[C@@H](CCC(=O)O)[C@H]2C(=O)N(Cc3ccccc3Cl)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H24ClN3O5/c1-12-7-8-15-21(13(12)2)27-24(34)25(15)20-19(17(28-25)9-10-18(30)31)22(32)29(23(20)33)11-14-5-3-4-6-16(14)26/h3-8,17,19-20,28H,9-11H2,1-2H3,(H,27,34)(H,30,31)/t17-,19+,20+,25+/m0/s1 |
| InChIKey | HSQYHTRAVXDHOS-LOJFUVEFSA-N |
| XLogP | 2.74 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|