C23H19Cl2N5O6 — CID 100847704
3-[(1R,3S,3aS,6aR)-6'-chloro-5-(4-chloro-3-nitrophenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 100847704) has the molecular formula C23H19Cl2N5O6 and a molecular weight of 532.34 g/mol. Its IUPAC name is 3-[(1R,3S,3aS,6aR)-6'-chloro-5-(4-chloro-3-nitrophenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1R,3S,3aS,6aR)-6'-chloro-5-(4-chloro-3-nitrophenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 100847704 |
| Molecular Formula | C23H19Cl2N5O6 |
| Molecular Weight | 532.34 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 3-[(1R,3S,3aS,6aR)-6'-chloro-5-(4-chloro-3-nitrophenyl)-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)[C@@]21N[C@H](CCC(N)=O)[C@@H]2C(=O)N(c3ccc(Cl)c([N+](=O)[O-])c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H19Cl2N5O6/c1-9-12(24)5-3-11-19(9)27-22(34)23(11)18-17(14(28-23)6-7-16(26)31)20(32)29(21(18)33)10-2-4-13(25)15(8-10)30(35)36/h2-5,8,14,17-18,28H,6-7H2,1H3,(H2,26,31)(H,27,34)/t14-,17+,18-,23-/m1/s1 |
| InChIKey | UTOXIFKEGRUGKK-PIJCVIKBSA-N |
| XLogP | 2.40 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|