C18H22N4 — CID 119109317
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (PubChem CID 119109317) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 119109317 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| SMILES | CC(NCC1CC2C=CC1C2)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H22N4/c1-13(20-10-17-9-14-2-3-16(17)8-14)15-4-6-18(7-5-15)22-12-19-11-21-22/h2-7,11-14,16-17,20H,8-10H2,1H3 |
| InChIKey | PDNRYGNJAGAEAQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|