C18H23N7 — CID 136817387
(1S)-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (PubChem CID 136817387) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is (1S)-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine.
| Compound Name | (1S)-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 136817387 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (1S)-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| SMILES | Cc1cc2n(n1)C[C@H](CN[C@@H](C)c1ccc(-n3cncn3)cc1)CN2 |
| InChI | InChI=1S/C18H23N7/c1-13-7-18-21-9-15(10-24(18)23-13)8-20-14(2)16-3-5-17(6-4-16)25-12-19-11-22-25/h3-7,11-12,14-15,20-21H,8-10H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | MCQIXSXLJPFZDK-LSDHHAIUSA-N |
| XLogP | 2.16 |
| TPSA | 72.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |