C16H22FNO5 — CID 119109702
5-[5-fluoro-2-(2-methoxyethoxy)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 119109702) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[5-fluoro-2-(2-methoxyethoxy)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[5-fluoro-2-(2-methoxyethoxy)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 119109702 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 5-[5-fluoro-2-(2-methoxyethoxy)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | COCCOc1ccc(F)cc1NC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C16H22FNO5/c1-16(2,10-15(20)21)9-14(19)18-12-8-11(17)4-5-13(12)23-7-6-22-3/h4-5,8H,6-7,9-10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | KRXJKKNWHMBYLZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|