C17H23ClN4 — CID 119109850
1-[(4-chlorophenyl)methyl]-N-[(3-methylimidazol-4-yl)methyl]piperidin-4-amine (PubChem CID 119109850) has the molecular formula C17H23ClN4 and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(3-methylimidazol-4-yl)methyl]piperidin-4-amine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(3-methylimidazol-4-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 119109850 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(3-methylimidazol-4-yl)methyl]piperidin-4-amine |
| SMILES | Cn1cncc1CNC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN4/c1-21-13-19-10-17(21)11-20-16-6-8-22(9-7-16)12-14-2-4-15(18)5-3-14/h2-5,10,13,16,20H,6-9,11-12H2,1H3 |
| InChIKey | FRHWSMVOCBBIME-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |