C16H19FN4O — CID 122145629
1-[(4-fluorophenyl)methyl]-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one (PubChem CID 122145629) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 122145629 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one |
| SMILES | Cn1cncc1CNC1CCN(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H19FN4O/c1-20-11-18-8-14(20)9-19-15-6-7-21(16(15)22)10-12-2-4-13(17)5-3-12/h2-5,8,11,15,19H,6-7,9-10H2,1H3 |
| InChIKey | XMEDNJLTDXSMTB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |