C15H17ClN4O — CID 124556757
(3S)-1-(2-chlorophenyl)-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one (PubChem CID 124556757) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is (3S)-1-(2-chlorophenyl)-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one.
| Compound Name | (3S)-1-(2-chlorophenyl)-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 124556757 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3S)-1-(2-chlorophenyl)-3-[(3-methylimidazol-4-yl)methylamino]pyrrolidin-2-one |
| SMILES | Cn1cncc1CN[C@H]1CCN(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C15H17ClN4O/c1-19-10-17-8-11(19)9-18-13-6-7-20(15(13)21)14-5-3-2-4-12(14)16/h2-5,8,10,13,18H,6-7,9H2,1H3/t13-/m0/s1 |
| InChIKey | CGWSFJCJJQWQQH-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |