C21H25N3O — CID 119109918
N,N-diethyl-4-[(1H-indol-4-ylmethylamino)methyl]benzamide (PubChem CID 119109918) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N,N-diethyl-4-[(1H-indol-4-ylmethylamino)methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(1H-indol-4-ylmethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 119109918 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N,N-diethyl-4-[(1H-indol-4-ylmethylamino)methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CNCc2cccc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C21H25N3O/c1-3-24(4-2)21(25)17-10-8-16(9-11-17)14-22-15-18-6-5-7-20-19(18)12-13-23-20/h5-13,22-23H,3-4,14-15H2,1-2H3 |
| InChIKey | WDYPEWRUFJQLRG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |