C19H27N3S — CID 119110022
1-(1H-indol-4-yl)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]methanamine (PubChem CID 119110022) has the molecular formula C19H27N3S and a molecular weight of 329.51 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]methanamine.
| Compound Name | 1-(1H-indol-4-yl)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]methanamine |
|---|---|
| PubChem CID | 119110022 |
| Molecular Formula | C19H27N3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(1H-indol-4-yl)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]methanamine |
| SMILES | c1cc(CNCC2(N3CCSCC3)CCCC2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C19H27N3S/c1-2-8-19(7-1,22-10-12-23-13-11-22)15-20-14-16-4-3-5-18-17(16)6-9-21-18/h3-6,9,20-21H,1-2,7-8,10-15H2 |
| InChIKey | BGKVRQGKOHYFEJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |