C19H23N3 — CID 119110220
N'-benzyl-N-(1H-indol-4-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 119110220) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N'-benzyl-N-(1H-indol-4-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-benzyl-N-(1H-indol-4-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 119110220 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N'-benzyl-N-(1H-indol-4-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1cccc2[nH]ccc12)Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3/c1-22(15-16-6-3-2-4-7-16)13-12-20-14-17-8-5-9-19-18(17)10-11-21-19/h2-11,20-21H,12-15H2,1H3 |
| InChIKey | UJBUWCLEBRBBAB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|