C18H23N5 — CID 119110667
3-[[[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]amino]methyl]benzonitrile (PubChem CID 119110667) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 3-[[[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 119110667 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 3-[[[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]amino]methyl]benzonitrile |
| SMILES | CCN1CCC(n2nccc2NCc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C18H23N5/c1-2-22-10-7-17(8-11-22)23-18(6-9-21-23)20-14-16-5-3-4-15(12-16)13-19/h3-6,9,12,17,20H,2,7-8,10-11,14H2,1H3 |
| InChIKey | RPFKVCHOTIUPGM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |