C18H25N5O — CID 119836594
4-(aminomethyl)-N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]benzamide (PubChem CID 119836594) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 119836594 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]benzamide |
| SMILES | CCN1CCC(n2nccc2NC(=O)c2ccc(CN)cc2)CC1 |
| InChI | InChI=1S/C18H25N5O/c1-2-22-11-8-16(9-12-22)23-17(7-10-20-23)21-18(24)15-5-3-14(13-19)4-6-15/h3-7,10,16H,2,8-9,11-13,19H2,1H3,(H,21,24) |
| InChIKey | JOMAHUMBLSCIIZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |